C63H118N2O11 — CID 162764437
8-O-heptadecan-9-yl 1-O-[2-[(8-heptadecan-9-yloxy-8-oxooctanoyl)oxymethyl]-3-[3-(4-methylpiperazin-1-yl)propoxycarbonyloxy]propyl] octanedioate (PubChem CID 162764437) has the molecular formula C63H118N2O11 and a molecular weight of 1079.64 g/mol. Its IUPAC name is 8-O-heptadecan-9-yl 1-O-[2-[(8-heptadecan-9-yloxy-8-oxooctanoyl)oxymethyl]-3-[3-(4-methylpiperazin-1-yl)propoxycarbonyloxy]propyl] octanedioate.
| Compound Name | 8-O-heptadecan-9-yl 1-O-[2-[(8-heptadecan-9-yloxy-8-oxooctanoyl)oxymethyl]-3-[3-(4-methylpiperazin-1-yl)propoxycarbonyloxy]propyl] octanedioate |
|---|---|
| PubChem CID | 162764437 |
| Molecular Formula | C63H118N2O11 |
| Molecular Weight | 1079.64 g/mol |
| Exact Mass | 1078.87 |
| IUPAC Name | 8-O-heptadecan-9-yl 1-O-[2-[(8-heptadecan-9-yloxy-8-oxooctanoyl)oxymethyl]-3-[3-(4-methylpiperazin-1-yl)propoxycarbonyloxy]propyl] octanedioate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCC(=O)OCC(COC(=O)CCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)COC(=O)OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C63H118N2O11/c1-6-10-14-18-22-30-39-57(40-31-23-19-15-11-7-2)75-61(68)45-36-28-26-34-43-59(66)72-53-56(55-74-63(70)71-52-38-47-65-50-48-64(5)49-51-65)54-73-60(67)44-35-27-29-37-46-62(69)76-58(41-32-24-20-16-12-8-3)42-33-25-21-17-13-9-4/h56-58H,6-55H2,1-5H3 |
| InChIKey | YQQMBVJZESURSL-UHFFFAOYSA-N |
| XLogP | 15.99 |
| TPSA | 147.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.64 |
| LogP ≤ 5 | 15.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|