C54H102N2O11 — CID 162764459
1-O-[2-[(7-decoxy-7-oxoheptanoyl)oxymethyl]-3-[2-[2-(dimethylamino)ethyl-methylamino]ethoxycarbonyloxy]propyl] 8-O-heptadecan-9-yl octanedioate (PubChem CID 162764459) has the molecular formula C54H102N2O11 and a molecular weight of 955.41 g/mol. Its IUPAC name is 1-O-[2-[(7-decoxy-7-oxoheptanoyl)oxymethyl]-3-[2-[2-(dimethylamino)ethyl-methylamino]ethoxycarbonyloxy]propyl] 8-O-heptadecan-9-yl octanedioate.
| Compound Name | 1-O-[2-[(7-decoxy-7-oxoheptanoyl)oxymethyl]-3-[2-[2-(dimethylamino)ethyl-methylamino]ethoxycarbonyloxy]propyl] 8-O-heptadecan-9-yl octanedioate |
|---|---|
| PubChem CID | 162764459 |
| Molecular Formula | C54H102N2O11 |
| Molecular Weight | 955.41 g/mol |
| Exact Mass | 954.75 |
| IUPAC Name | 1-O-[2-[(7-decoxy-7-oxoheptanoyl)oxymethyl]-3-[2-[2-(dimethylamino)ethyl-methylamino]ethoxycarbonyloxy]propyl] 8-O-heptadecan-9-yl octanedioate |
| SMILES | CCCCCCCCCCOC(=O)CCCCCC(=O)OCC(COC(=O)CCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)COC(=O)OCCN(C)CCN(C)C |
| InChI | InChI=1S/C54H102N2O11/c1-7-10-13-16-19-20-25-33-43-62-50(57)36-31-26-32-38-52(59)65-46-48(47-66-54(61)63-44-42-56(6)41-40-55(4)5)45-64-51(58)37-29-23-24-30-39-53(60)67-49(34-27-21-17-14-11-8-2)35-28-22-18-15-12-9-3/h48-49H,7-47H2,1-6H3 |
| InChIKey | XHWLNGGETLBYRR-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 147.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.41 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|