C46H86O7 — CID 177257204
5-O-heptadecan-9-yl 1-O-[2-[[(Z)-octadec-9-enoxy]carbonyloxymethyl]butyl] pentanedioate (PubChem CID 177257204) has the molecular formula C46H86O7 and a molecular weight of 751.19 g/mol. Its IUPAC name is 5-O-heptadecan-9-yl 1-O-[2-[[(Z)-octadec-9-enoxy]carbonyloxymethyl]butyl] pentanedioate.
| Compound Name | 5-O-heptadecan-9-yl 1-O-[2-[[(Z)-octadec-9-enoxy]carbonyloxymethyl]butyl] pentanedioate |
|---|---|
| PubChem CID | 177257204 |
| Molecular Formula | C46H86O7 |
| Molecular Weight | 751.19 g/mol |
| Exact Mass | 750.64 |
| IUPAC Name | 5-O-heptadecan-9-yl 1-O-[2-[[(Z)-octadec-9-enoxy]carbonyloxymethyl]butyl] pentanedioate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)OCC(CC)COC(=O)CCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C46H86O7/c1-5-9-12-15-18-19-20-21-22-23-24-25-26-27-30-33-39-50-46(49)52-41-42(8-4)40-51-44(47)37-34-38-45(48)53-43(35-31-28-16-13-10-6-2)36-32-29-17-14-11-7-3/h21-22,42-43H,5-20,23-41H2,1-4H3/b22-21- |
| InChIKey | XVPUAYHWWROMCK-DQRAZIAOSA-N |
| XLogP | 14.33 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.19 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|