C45H82O8 — CID 177257165
heptadecan-9-yl 4-[2-methyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]carbonyloxypropoxy]carbonyloxybutanoate (PubChem CID 177257165) has the molecular formula C45H82O8 and a molecular weight of 751.14 g/mol. Its IUPAC name is heptadecan-9-yl 4-[2-methyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]carbonyloxypropoxy]carbonyloxybutanoate.
| Compound Name | heptadecan-9-yl 4-[2-methyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]carbonyloxypropoxy]carbonyloxybutanoate |
|---|---|
| PubChem CID | 177257165 |
| Molecular Formula | C45H82O8 |
| Molecular Weight | 751.14 g/mol |
| Exact Mass | 750.60 |
| IUPAC Name | heptadecan-9-yl 4-[2-methyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]carbonyloxypropoxy]carbonyloxybutanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)OCC(C)COC(=O)OCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C45H82O8/c1-5-8-11-14-17-18-19-20-21-22-23-24-25-26-29-32-37-49-44(47)51-39-41(4)40-52-45(48)50-38-33-36-43(46)53-42(34-30-27-15-12-9-6-2)35-31-28-16-13-10-7-3/h17-18,20-21,41-42H,5-16,19,22-40H2,1-4H3/b18-17-,21-20- |
| InChIKey | IPMPJIVZBRJQRJ-KSWDIIKGSA-N |
| XLogP | 13.94 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.14 |
| LogP ≤ 5 | 13.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|