C41H74O4 — CID 134728549
9-[(9Z,15Z,18Z)-tetracosa-9,15,18-trienoyl]oxyheptadecanoic acid (PubChem CID 134728549) has the molecular formula C41H74O4 and a molecular weight of 631.04 g/mol. Its IUPAC name is 9-[(9Z,15Z,18Z)-tetracosa-9,15,18-trienoyl]oxyheptadecanoic acid.
| Compound Name | 9-[(9Z,15Z,18Z)-tetracosa-9,15,18-trienoyl]oxyheptadecanoic acid |
|---|---|
| PubChem CID | 134728549 |
| Molecular Formula | C41H74O4 |
| Molecular Weight | 631.04 g/mol |
| Exact Mass | 630.56 |
| IUPAC Name | 9-[(9Z,15Z,18Z)-tetracosa-9,15,18-trienoyl]oxyheptadecanoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCC/C=C\CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC(=O)O |
| InChI | InChI=1S/C41H74O4/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-30-34-38-41(44)45-39(35-31-27-10-8-6-4-2)36-32-28-26-29-33-37-40(42)43/h11-12,14-15,20-21,39H,3-10,13,16-19,22-38H2,1-2H3,(H,42,43)/b12-11-,15-14-,21-20- |
| InChIKey | DYZLUTPCRFAELV-KFMRDIIWSA-N |
| XLogP | 13.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.04 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|