C42H78O4 — CID 174259035
6-[(26Z,29Z)-8-methylpentatriaconta-26,29-dien-17-yl]oxy-6-oxohexanoic acid (PubChem CID 174259035) has the molecular formula C42H78O4 and a molecular weight of 647.08 g/mol. Its IUPAC name is 6-[(26Z,29Z)-8-methylpentatriaconta-26,29-dien-17-yl]oxy-6-oxohexanoic acid.
| Compound Name | 6-[(26Z,29Z)-8-methylpentatriaconta-26,29-dien-17-yl]oxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 174259035 |
| Molecular Formula | C42H78O4 |
| Molecular Weight | 647.08 g/mol |
| Exact Mass | 646.59 |
| IUPAC Name | 6-[(26Z,29Z)-8-methylpentatriaconta-26,29-dien-17-yl]oxy-6-oxohexanoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCCC(C)CCCCCCC)OC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C42H78O4/c1-4-6-8-10-11-12-13-14-15-16-17-18-19-20-25-29-35-40(46-42(45)38-32-31-37-41(43)44)36-30-26-22-21-24-28-34-39(3)33-27-23-9-7-5-2/h11-12,14-15,39-40H,4-10,13,16-38H2,1-3H3,(H,43,44)/b12-11-,15-14- |
| InChIKey | HQAPDPBMUBJYEV-HDXUUTQWSA-N |
| XLogP | 13.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.08 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|