C44H85NO5 — CID 168821455
heptadecan-9-yl 6-[1-(2-hydroxyethyl)-2-(6-nonoxy-6-oxohexyl)pyrrolidin-3-yl]hexanoate (PubChem CID 168821455) has the molecular formula C44H85NO5 and a molecular weight of 708.17 g/mol. Its IUPAC name is heptadecan-9-yl 6-[1-(2-hydroxyethyl)-2-(6-nonoxy-6-oxohexyl)pyrrolidin-3-yl]hexanoate.
| Compound Name | heptadecan-9-yl 6-[1-(2-hydroxyethyl)-2-(6-nonoxy-6-oxohexyl)pyrrolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 168821455 |
| Molecular Formula | C44H85NO5 |
| Molecular Weight | 708.17 g/mol |
| Exact Mass | 707.64 |
| IUPAC Name | heptadecan-9-yl 6-[1-(2-hydroxyethyl)-2-(6-nonoxy-6-oxohexyl)pyrrolidin-3-yl]hexanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCC1C(CCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCN1CCO |
| InChI | InChI=1S/C44H85NO5/c1-4-7-10-13-16-19-28-39-49-43(47)33-26-21-25-32-42-40(35-36-45(42)37-38-46)29-22-20-27-34-44(48)50-41(30-23-17-14-11-8-5-2)31-24-18-15-12-9-6-3/h40-42,46H,4-39H2,1-3H3 |
| InChIKey | QJJUYFJBFYIAOV-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.17 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|