C39H72O5 — CID 166495480
1-[2-[3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]oxyundecan-3-yl 2-hexyldecanoate (PubChem CID 166495480) has the molecular formula C39H72O5 and a molecular weight of 621.00 g/mol. Its IUPAC name is 1-[2-[3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]oxyundecan-3-yl 2-hexyldecanoate.
| Compound Name | 1-[2-[3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]oxyundecan-3-yl 2-hexyldecanoate |
|---|---|
| PubChem CID | 166495480 |
| Molecular Formula | C39H72O5 |
| Molecular Weight | 621.00 g/mol |
| Exact Mass | 620.54 |
| IUPAC Name | 1-[2-[3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]oxyundecan-3-yl 2-hexyldecanoate |
| SMILES | CC/C=C\CC1C(O)CCC1CC(=O)OCCC(CCCCCCCC)OC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C39H72O5/c1-5-9-13-16-18-22-25-33(24-21-15-11-7-3)39(42)44-35(26-23-19-17-14-10-6-2)30-31-43-38(41)32-34-28-29-37(40)36(34)27-20-12-8-4/h12,20,33-37,40H,5-11,13-19,21-32H2,1-4H3/b20-12- |
| InChIKey | RQDVWIFMSMMLGS-NDENLUEZSA-N |
| XLogP | 11.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.00 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|