C54H96N2O4 — CID 166495643
[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 2-[3-[2-(dimethylamino)ethoxycarbonylamino]-2-[(Z)-pent-2-enyl]cyclopentyl]acetate (PubChem CID 166495643) has the molecular formula C54H96N2O4 and a molecular weight of 837.37 g/mol. Its IUPAC name is [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 2-[3-[2-(dimethylamino)ethoxycarbonylamino]-2-[(Z)-pent-2-enyl]cyclopentyl]acetate.
| Compound Name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 2-[3-[2-(dimethylamino)ethoxycarbonylamino]-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 166495643 |
| Molecular Formula | C54H96N2O4 |
| Molecular Weight | 837.37 g/mol |
| Exact Mass | 836.74 |
| IUPAC Name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 2-[3-[2-(dimethylamino)ethoxycarbonylamino]-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
| SMILES | CC/C=C\CC1C(CC(=O)OC(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCC/C=C\C/C=C\CCCCC)CCC1NC(=O)OCCN(C)C |
| InChI | InChI=1S/C54H96N2O4/c1-6-9-12-14-16-18-20-22-24-26-28-30-32-34-36-39-41-50(42-40-37-35-33-31-29-27-25-23-21-19-17-15-13-10-7-2)60-53(57)48-49-44-45-52(51(49)43-38-11-8-3)55-54(58)59-47-46-56(4)5/h11,16-19,22-25,38,49-52H,6-10,12-15,20-21,26-37,39-48H2,1-5H3,(H,55,58)/b18-16-,19-17-,24-22-,25-23-,38-11- |
| InChIKey | ASOLKFBXBXWZGH-WELQKYSFSA-N |
| XLogP | 15.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.37 |
| LogP ≤ 5 | 15.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|