C40H74N2O3 — CID 170026720
[(4Z,7Z,26Z,29Z)-1-hydroxytetratriaconta-4,7,26,29-tetraen-17-yl] N-[3-(dimethylamino)propyl]carbamate (PubChem CID 170026720) has the molecular formula C40H74N2O3 and a molecular weight of 631.04 g/mol. Its IUPAC name is [(4Z,7Z,26Z,29Z)-1-hydroxytetratriaconta-4,7,26,29-tetraen-17-yl] N-[3-(dimethylamino)propyl]carbamate.
| Compound Name | [(4Z,7Z,26Z,29Z)-1-hydroxytetratriaconta-4,7,26,29-tetraen-17-yl] N-[3-(dimethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 170026720 |
| Molecular Formula | C40H74N2O3 |
| Molecular Weight | 631.04 g/mol |
| Exact Mass | 630.57 |
| IUPAC Name | [(4Z,7Z,26Z,29Z)-1-hydroxytetratriaconta-4,7,26,29-tetraen-17-yl] N-[3-(dimethylamino)propyl]carbamate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCO)OC(=O)NCCCN(C)C |
| InChI | InChI=1S/C40H74N2O3/c1-4-5-6-7-8-9-10-11-12-15-18-21-24-27-30-34-39(45-40(44)41-36-33-37-42(2)3)35-31-28-25-22-19-16-13-14-17-20-23-26-29-32-38-43/h7-8,10-11,14,17,23,26,39,43H,4-6,9,12-13,15-16,18-22,24-25,27-38H2,1-3H3,(H,41,44)/b8-7-,11-10-,17-14-,26-23- |
| InChIKey | UQWRIBZZQCJIMX-DLRULNEQSA-N |
| XLogP | 11.24 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.04 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|