C39H73NO — CID 54674315
N,N-dimethyl-2-[(5E,8E,26E,29E)-pentatriaconta-5,8,26,29-tetraen-18-yl]oxyethanamine (PubChem CID 54674315) has the molecular formula C39H73NO and a molecular weight of 572.02 g/mol. Its IUPAC name is N,N-dimethyl-2-[(5E,8E,26E,29E)-pentatriaconta-5,8,26,29-tetraen-18-yl]oxyethanamine.
| Compound Name | N,N-dimethyl-2-[(5E,8E,26E,29E)-pentatriaconta-5,8,26,29-tetraen-18-yl]oxyethanamine |
|---|---|
| PubChem CID | 54674315 |
| Molecular Formula | C39H73NO |
| Molecular Weight | 572.02 g/mol |
| Exact Mass | 571.57 |
| IUPAC Name | N,N-dimethyl-2-[(5E,8E,26E,29E)-pentatriaconta-5,8,26,29-tetraen-18-yl]oxyethanamine |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCCC(CCCCCCC/C=C/C/C=C/CCCCC)OCCN(C)C |
| InChI | InChI=1S/C39H73NO/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39(41-38-37-40(3)4)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h11,13-14,16-17,19-20,22,39H,5-10,12,15,18,21,23-38H2,1-4H3/b13-11+,16-14+,19-17+,22-20+ |
| InChIKey | OLWVTMUWQDSOQK-VCXHTEFYSA-N |
| XLogP | 12.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.02 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|