C22H47NO — CID 140938522
3-heptadecan-9-yloxy-N,N-dimethylpropan-1-amine (PubChem CID 140938522) has the molecular formula C22H47NO and a molecular weight of 341.62 g/mol. Its IUPAC name is 3-heptadecan-9-yloxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-heptadecan-9-yloxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 140938522 |
| Molecular Formula | C22H47NO |
| Molecular Weight | 341.62 g/mol |
| Exact Mass | 341.37 |
| IUPAC Name | 3-heptadecan-9-yloxy-N,N-dimethylpropan-1-amine |
| SMILES | CCCCCCCCC(CCCCCCCC)OCCCN(C)C |
| InChI | InChI=1S/C22H47NO/c1-5-7-9-11-13-15-18-22(24-21-17-20-23(3)4)19-16-14-12-10-8-6-2/h22H,5-21H2,1-4H3 |
| InChIKey | AFKCNEZTCPGKEV-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.62 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|