C16H32ClNO5 — CID 171629245
6-[3-(dimethylamino)propoxy]undecanedioic acid;hydrochloride (PubChem CID 171629245) has the molecular formula C16H32ClNO5 and a molecular weight of 353.89 g/mol. Its IUPAC name is 6-[3-(dimethylamino)propoxy]undecanedioic acid;hydrochloride.
| Compound Name | 6-[3-(dimethylamino)propoxy]undecanedioic acid;hydrochloride |
|---|---|
| PubChem CID | 171629245 |
| Molecular Formula | C16H32ClNO5 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 6-[3-(dimethylamino)propoxy]undecanedioic acid;hydrochloride |
| SMILES | CN(C)CCCOC(CCCCC(=O)O)CCCCC(=O)O.Cl |
| InChI | InChI=1S/C16H31NO5.ClH/c1-17(2)12-7-13-22-14(8-3-5-10-15(18)19)9-4-6-11-16(20)21;/h14H,3-13H2,1-2H3,(H,18,19)(H,20,21);1H |
| InChIKey | HELNDJYRVLCPKM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|