C20H39NO3 — CID 171629292
7-[3-(dimethylamino)propoxy]-3,11-dimethyltridecane-4,10-dione (PubChem CID 171629292) has the molecular formula C20H39NO3 and a molecular weight of 341.54 g/mol. Its IUPAC name is 7-[3-(dimethylamino)propoxy]-3,11-dimethyltridecane-4,10-dione.
| Compound Name | 7-[3-(dimethylamino)propoxy]-3,11-dimethyltridecane-4,10-dione |
|---|---|
| PubChem CID | 171629292 |
| Molecular Formula | C20H39NO3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.29 |
| IUPAC Name | 7-[3-(dimethylamino)propoxy]-3,11-dimethyltridecane-4,10-dione |
| SMILES | CCC(C)C(=O)CCC(CCC(=O)C(C)CC)OCCCN(C)C |
| InChI | InChI=1S/C20H39NO3/c1-7-16(3)19(22)12-10-18(24-15-9-14-21(5)6)11-13-20(23)17(4)8-2/h16-18H,7-15H2,1-6H3 |
| InChIKey | INQMEYFPYSYMCX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|