C46H88Cl2N2O8 — CID 167601961
9-[4-(dimethylamino)butoxy]heptadecanedioic acid;9-[4-(dimethylamino)butoxy]heptadecanedioyl dichloride (PubChem CID 167601961) has the molecular formula C46H88Cl2N2O8 and a molecular weight of 868.12 g/mol. Its IUPAC name is 9-[4-(dimethylamino)butoxy]heptadecanedioic acid;9-[4-(dimethylamino)butoxy]heptadecanedioyl dichloride.
| Compound Name | 9-[4-(dimethylamino)butoxy]heptadecanedioic acid;9-[4-(dimethylamino)butoxy]heptadecanedioyl dichloride |
|---|---|
| PubChem CID | 167601961 |
| Molecular Formula | C46H88Cl2N2O8 |
| Molecular Weight | 868.12 g/mol |
| Exact Mass | 866.59 |
| IUPAC Name | 9-[4-(dimethylamino)butoxy]heptadecanedioic acid;9-[4-(dimethylamino)butoxy]heptadecanedioyl dichloride |
| SMILES | CN(C)CCCCOC(CCCCCCCC(=O)Cl)CCCCCCCC(=O)Cl.CN(C)CCCCOC(CCCCCCCC(=O)O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C23H43Cl2NO3.C23H45NO5/c1-26(2)19-13-14-20-29-21(15-9-5-3-7-11-17-22(24)27)16-10-6-4-8-12-18-23(25)28;1-24(2)19-13-14-20-29-21(15-9-5-3-7-11-17-22(25)26)16-10-6-4-8-12-18-23(27)28/h21H,3-20H2,1-2H3;21H,3-20H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | JWBCDRMWJOUQNZ-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.12 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|