C22H41NO6 — CID 153294077
8-[4-(dimethylamino)butanoyloxy]hexadecanedioic acid (PubChem CID 153294077) has the molecular formula C22H41NO6 and a molecular weight of 415.57 g/mol. Its IUPAC name is 8-[4-(dimethylamino)butanoyloxy]hexadecanedioic acid.
| Compound Name | 8-[4-(dimethylamino)butanoyloxy]hexadecanedioic acid |
|---|---|
| PubChem CID | 153294077 |
| Molecular Formula | C22H41NO6 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | 8-[4-(dimethylamino)butanoyloxy]hexadecanedioic acid |
| SMILES | CN(C)CCCC(=O)OC(CCCCCCCC(=O)O)CCCCCCC(=O)O |
| InChI | InChI=1S/C22H41NO6/c1-23(2)18-12-17-22(28)29-19(14-9-6-7-11-16-21(26)27)13-8-4-3-5-10-15-20(24)25/h19H,3-18H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | CPSNADDIQNINCF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|