About undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate
undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate (PubChem CID 166116653) has the molecular formula C41H81NO5
and a molecular weight of 668.10 g/mol. Its IUPAC name is undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate.
Molecular Properties
| Compound Name | undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate |
| PubChem CID | 166116653 |
| Molecular Formula | C41H81NO5 |
| Molecular Weight | 668.10 g/mol |
| Exact Mass | 667.61 |
| IUPAC Name | undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate |
| SMILES | CCCCCCCC(CCCCCCC)OCCCCC(CCCC(=O)OC(CCCCC)CCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C41H81NO5/c1-7-11-15-17-21-27-37(28-22-18-16-12-8-2)45-36-24-23-31-39(47-41(44)34-26-35-42(5)6)32-25-33-40(43)46-38(29-19-13-9-3)30-20-14-10-4/h37-39H,7-36H2,1-6H3 |
| InChIKey | BUIBXRYWJSVELX-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 668.10 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate?
The IUPAC name of undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate (CID 166116653) is undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate.
What is the SMILES notation for undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate?
The canonical SMILES for undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate is CCCCCCCC(CCCCCCC)OCCCCC(CCCC(=O)OC(CCCCC)CCCCC)OC(=O)CCCN(C)C.
What is the InChIKey of undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate?
The InChIKey is BUIBXRYWJSVELX-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H81NO5/c1-7-11-15-17-21-27-37(28-22-18-16-12-8-2)45-36-24-23-31-39(47-41(44)34-26-35-42(5)6)32-25-33-40(43)46-38(29-19-13-9-3)30-20-14-10-4/h37-39H,7-36H2,1-6H3.
What are the key properties of undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate?
undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate has a molecular weight of 668.10 g/mol, XLogP of 11.76, 36 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for undecan-6-yl 5-[4-(dimethylamino)butanoyloxy]-9-pentadecan-8-yloxynonanoate is sourced from PubChem (CID 166116653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).