C35H69NO5 — CID 175580113
9-[4-[methyl(propan-2-yl)amino]butoxy]-2-(5-methyl-2-propan-2-ylhexyl)heptadecanedioic acid (PubChem CID 175580113) has the molecular formula C35H69NO5 and a molecular weight of 583.94 g/mol. Its IUPAC name is 9-[4-[methyl(propan-2-yl)amino]butoxy]-2-(5-methyl-2-propan-2-ylhexyl)heptadecanedioic acid.
| Compound Name | 9-[4-[methyl(propan-2-yl)amino]butoxy]-2-(5-methyl-2-propan-2-ylhexyl)heptadecanedioic acid |
|---|---|
| PubChem CID | 175580113 |
| Molecular Formula | C35H69NO5 |
| Molecular Weight | 583.94 g/mol |
| Exact Mass | 583.52 |
| IUPAC Name | 9-[4-[methyl(propan-2-yl)amino]butoxy]-2-(5-methyl-2-propan-2-ylhexyl)heptadecanedioic acid |
| SMILES | CC(C)CCC(CC(CCCCCCC(CCCCCCCC(=O)O)OCCCCN(C)C(C)C)C(=O)O)C(C)C |
| InChI | InChI=1S/C35H69NO5/c1-28(2)23-24-31(29(3)4)27-32(35(39)40)19-13-11-12-15-21-33(20-14-9-8-10-16-22-34(37)38)41-26-18-17-25-36(7)30(5)6/h28-33H,8-27H2,1-7H3,(H,37,38)(H,39,40) |
| InChIKey | MZODWORJMQHOOV-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.94 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|