C20H41NO — CID 171629250
N,N-dimethyl-3-trideca-1,12-dien-7-yloxypropan-1-amine;ethane (PubChem CID 171629250) has the molecular formula C20H41NO and a molecular weight of 311.55 g/mol. Its IUPAC name is N,N-dimethyl-3-trideca-1,12-dien-7-yloxypropan-1-amine;ethane.
| Compound Name | N,N-dimethyl-3-trideca-1,12-dien-7-yloxypropan-1-amine;ethane |
|---|---|
| PubChem CID | 171629250 |
| Molecular Formula | C20H41NO |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.32 |
| IUPAC Name | N,N-dimethyl-3-trideca-1,12-dien-7-yloxypropan-1-amine;ethane |
| SMILES | C=CCCCCC(CCCCC=C)OCCCN(C)C.CC |
| InChI | InChI=1S/C18H35NO.C2H6/c1-5-7-9-11-14-18(15-12-10-8-6-2)20-17-13-16-19(3)4;1-2/h5-6,18H,1-2,7-17H2,3-4H3;1-2H3 |
| InChIKey | KWDCOCAQWVNCRA-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|