About 7-methoxynon-1-ene
7-methoxynon-1-ene (PubChem CID 91435315) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is 7-methoxynon-1-ene.
Molecular Properties
| Compound Name | 7-methoxynon-1-ene |
| PubChem CID | 91435315 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 7-methoxynon-1-ene |
| SMILES | C=CCCCCC(CC)OC |
| InChI | InChI=1S/C10H20O/c1-4-6-7-8-9-10(5-2)11-3/h4,10H,1,5-9H2,2-3H3 |
| InChIKey | PEJMURDSFDYVJN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxynon-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxynon-1-ene?
The IUPAC name of 7-methoxynon-1-ene (CID 91435315) is 7-methoxynon-1-ene.
What is the SMILES notation for 7-methoxynon-1-ene?
The canonical SMILES for 7-methoxynon-1-ene is C=CCCCCC(CC)OC.
What is the InChIKey of 7-methoxynon-1-ene?
The InChIKey is PEJMURDSFDYVJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O/c1-4-6-7-8-9-10(5-2)11-3/h4,10H,1,5-9H2,2-3H3.
What are the key properties of 7-methoxynon-1-ene?
7-methoxynon-1-ene has a molecular weight of 156.27 g/mol, XLogP of 3.16, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxynon-1-ene is sourced from PubChem (CID 91435315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).