C11H23NO2 — CID 107009425
1,1-dimethoxynon-8-en-2-amine (PubChem CID 107009425) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 1,1-dimethoxynon-8-en-2-amine.
| Compound Name | 1,1-dimethoxynon-8-en-2-amine |
|---|---|
| PubChem CID | 107009425 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 1,1-dimethoxynon-8-en-2-amine |
| SMILES | C=CCCCCCC(N)C(OC)OC |
| InChI | InChI=1S/C11H23NO2/c1-4-5-6-7-8-9-10(12)11(13-2)14-3/h4,10-11H,1,5-9,12H2,2-3H3 |
| InChIKey | HWJDDCNTZFNTAY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|