About octadec-17-ene-1,1-diamine
octadec-17-ene-1,1-diamine (PubChem CID 87111501) has the molecular formula C18H38N2
and a molecular weight of 282.52 g/mol. Its IUPAC name is octadec-17-ene-1,1-diamine.
Molecular Properties
| Compound Name | octadec-17-ene-1,1-diamine |
| PubChem CID | 87111501 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | octadec-17-ene-1,1-diamine |
| SMILES | C=CCCCCCCCCCCCCCCCC(N)N |
| InChI | InChI=1S/C18H38N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2,18H,1,3-17,19-20H2 |
| InChIKey | MJGFJDYCRWFDJR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze octadec-17-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadec-17-ene-1,1-diamine?
The IUPAC name of octadec-17-ene-1,1-diamine (CID 87111501) is octadec-17-ene-1,1-diamine.
What is the SMILES notation for octadec-17-ene-1,1-diamine?
The canonical SMILES for octadec-17-ene-1,1-diamine is C=CCCCCCCCCCCCCCCCC(N)N.
What is the InChIKey of octadec-17-ene-1,1-diamine?
The InChIKey is MJGFJDYCRWFDJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2,18H,1,3-17,19-20H2.
What are the key properties of octadec-17-ene-1,1-diamine?
octadec-17-ene-1,1-diamine has a molecular weight of 282.52 g/mol, XLogP of 5.27, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octadec-17-ene-1,1-diamine is sourced from PubChem (CID 87111501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).