About 11-bromohenicosa-1,20-diene
11-bromohenicosa-1,20-diene (PubChem CID 102253799) has the molecular formula C21H39Br
and a molecular weight of 371.45 g/mol. Its IUPAC name is 11-bromohenicosa-1,20-diene.
Molecular Properties
| Compound Name | 11-bromohenicosa-1,20-diene |
| PubChem CID | 102253799 |
| Molecular Formula | C21H39Br |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 11-bromohenicosa-1,20-diene |
| SMILES | C=CCCCCCCCCC(Br)CCCCCCCCC=C |
| InChI | InChI=1S/C21H39Br/c1-3-5-7-9-11-13-15-17-19-21(22)20-18-16-14-12-10-8-6-4-2/h3-4,21H,1-2,5-20H2 |
| InChIKey | NVRJGQDSYBXNTC-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 11-bromohenicosa-1,20-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-bromohenicosa-1,20-diene?
The IUPAC name of 11-bromohenicosa-1,20-diene (CID 102253799) is 11-bromohenicosa-1,20-diene.
What is the SMILES notation for 11-bromohenicosa-1,20-diene?
The canonical SMILES for 11-bromohenicosa-1,20-diene is C=CCCCCCCCCC(Br)CCCCCCCCC=C.
What is the InChIKey of 11-bromohenicosa-1,20-diene?
The InChIKey is NVRJGQDSYBXNTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H39Br/c1-3-5-7-9-11-13-15-17-19-21(22)20-18-16-14-12-10-8-6-4-2/h3-4,21H,1-2,5-20H2.
What are the key properties of 11-bromohenicosa-1,20-diene?
11-bromohenicosa-1,20-diene has a molecular weight of 371.45 g/mol, XLogP of 8.36, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 11-bromohenicosa-1,20-diene is sourced from PubChem (CID 102253799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).