About 2-dec-9-enylpropane-1,3-diol
2-dec-9-enylpropane-1,3-diol (PubChem CID 135271441) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-dec-9-enylpropane-1,3-diol.
Molecular Properties
| Compound Name | 2-dec-9-enylpropane-1,3-diol |
| PubChem CID | 135271441 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 2-dec-9-enylpropane-1,3-diol |
| SMILES | C=CCCCCCCCCC(CO)CO |
| InChI | InChI=1S/C13H26O2/c1-2-3-4-5-6-7-8-9-10-13(11-14)12-15/h2,13-15H,1,3-12H2 |
| InChIKey | NAURUOJHIHWKRE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-dec-9-enylpropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dec-9-enylpropane-1,3-diol?
The IUPAC name of 2-dec-9-enylpropane-1,3-diol (CID 135271441) is 2-dec-9-enylpropane-1,3-diol.
What is the SMILES notation for 2-dec-9-enylpropane-1,3-diol?
The canonical SMILES for 2-dec-9-enylpropane-1,3-diol is C=CCCCCCCCCC(CO)CO.
What is the InChIKey of 2-dec-9-enylpropane-1,3-diol?
The InChIKey is NAURUOJHIHWKRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-2-3-4-5-6-7-8-9-10-13(11-14)12-15/h2,13-15H,1,3-12H2.
What are the key properties of 2-dec-9-enylpropane-1,3-diol?
2-dec-9-enylpropane-1,3-diol has a molecular weight of 214.35 g/mol, XLogP of 2.89, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dec-9-enylpropane-1,3-diol is sourced from PubChem (CID 135271441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).