C15H30O3 — CID 11747294
(4R,5R)-pentadec-14-ene-1,4,5-triol (PubChem CID 11747294) has the molecular formula C15H30O3 and a molecular weight of 258.40 g/mol. Its IUPAC name is (4R,5R)-pentadec-14-ene-1,4,5-triol.
| Compound Name | (4R,5R)-pentadec-14-ene-1,4,5-triol |
|---|---|
| PubChem CID | 11747294 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | (4R,5R)-pentadec-14-ene-1,4,5-triol |
| SMILES | C=CCCCCCCCC[C@@H](O)[C@H](O)CCCO |
| InChI | InChI=1S/C15H30O3/c1-2-3-4-5-6-7-8-9-11-14(17)15(18)12-10-13-16/h2,14-18H,1,3-13H2/t14-,15-/m1/s1 |
| InChIKey | GJTCVCCEDSBHNA-HUUCEWRRSA-N |
| XLogP | 2.79 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|