C13H28O4 — CID 57164237
tridecane-1,4,5,13-tetrol (PubChem CID 57164237) has the molecular formula C13H28O4 and a molecular weight of 248.36 g/mol. Its IUPAC name is tridecane-1,4,5,13-tetrol.
| Compound Name | tridecane-1,4,5,13-tetrol |
|---|---|
| PubChem CID | 57164237 |
| Molecular Formula | C13H28O4 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | tridecane-1,4,5,13-tetrol |
| SMILES | OCCCCCCCCC(O)C(O)CCCO |
| InChI | InChI=1S/C13H28O4/c14-10-6-4-2-1-3-5-8-12(16)13(17)9-7-11-15/h12-17H,1-11H2 |
| InChIKey | XDTHWKKKMBOLLG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|