(9R,10R)-9,10,16-trihydroxyhexadecanoic acid

C16H32O5 — CID 7060884

IUPAC(9R,10R)-9,10,16-trihydroxyhexadecanoic acid
SMILESO=C(O)CCCCCCC[C@@H](O)[C@H](O)CCCCCCO
InChIInChI=1S/C16H32O5/c17-13-9-5-4-7-11-15(19)14(18)10-6-2-1-3-8-12-16(20)21/h14-15,17-19H,1-13H2,(H,20,21)/t14-,15-/m1/s1
InChIKeyMEHUJCGAYMDLEL-HUUCEWRRSA-N
MW304.43 g/mol
LogP2.47
Rot. Bonds15

About (9R,10R)-9,10,16-trihydroxyhexadecanoic acid

(9R,10R)-9,10,16-trihydroxyhexadecanoic acid (PubChem CID 7060884) has the molecular formula C16H32O5 and a molecular weight of 304.43 g/mol. Its IUPAC name is (9R,10R)-9,10,16-trihydroxyhexadecanoic acid.

Molecular Properties

Compound Name(9R,10R)-9,10,16-trihydroxyhexadecanoic acid
PubChem CID7060884
Molecular FormulaC16H32O5
Molecular Weight304.43 g/mol
Exact Mass304.22
IUPAC Name(9R,10R)-9,10,16-trihydroxyhexadecanoic acid
SMILESO=C(O)CCCCCCC[C@@H](O)[C@H](O)CCCCCCO
InChIInChI=1S/C16H32O5/c17-13-9-5-4-7-11-15(19)14(18)10-6-2-1-3-8-12-16(20)21/h14-15,17-19H,1-13H2,(H,20,21)/t14-,15-/m1/s1
InChIKeyMEHUJCGAYMDLEL-HUUCEWRRSA-N
XLogP2.47
TPSA97.99 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds15
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.43
LogP ≤ 52.47
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (9R,10R)-9,10,16-trihydroxyhexadecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (9R,10R)-9,10,16-trihydroxyhexadecanoic acid?
The IUPAC name of (9R,10R)-9,10,16-trihydroxyhexadecanoic acid (CID 7060884) is (9R,10R)-9,10,16-trihydroxyhexadecanoic acid.
What is the SMILES notation for (9R,10R)-9,10,16-trihydroxyhexadecanoic acid?
The canonical SMILES for (9R,10R)-9,10,16-trihydroxyhexadecanoic acid is O=C(O)CCCCCCC[C@@H](O)[C@H](O)CCCCCCO.
What is the InChIKey of (9R,10R)-9,10,16-trihydroxyhexadecanoic acid?
The InChIKey is MEHUJCGAYMDLEL-HUUCEWRRSA-N. The full InChI is InChI=1S/C16H32O5/c17-13-9-5-4-7-11-15(19)14(18)10-6-2-1-3-8-12-16(20)21/h14-15,17-19H,1-13H2,(H,20,21)/t14-,15-/m1/s1.
What are the key properties of (9R,10R)-9,10,16-trihydroxyhexadecanoic acid?
(9R,10R)-9,10,16-trihydroxyhexadecanoic acid has a molecular weight of 304.43 g/mol, XLogP of 2.47, 15 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9R,10R)-9,10,16-trihydroxyhexadecanoic acid is sourced from PubChem (CID 7060884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).