C9H20O3 — CID 174941867
nonane-1,5,6-triol (PubChem CID 174941867) has the molecular formula C9H20O3 and a molecular weight of 176.26 g/mol. Its IUPAC name is nonane-1,5,6-triol.
| Compound Name | nonane-1,5,6-triol |
|---|---|
| PubChem CID | 174941867 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | nonane-1,5,6-triol |
| SMILES | CCCC(O)C(O)CCCCO |
| InChI | InChI=1S/C9H20O3/c1-2-5-8(11)9(12)6-3-4-7-10/h8-12H,2-7H2,1H3 |
| InChIKey | FJHMRJUICXOWSO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|