C9H20O4 — CID 87488161
nonane-1,2,3,9-tetrol (PubChem CID 87488161) has the molecular formula C9H20O4 and a molecular weight of 192.25 g/mol. Its IUPAC name is nonane-1,2,3,9-tetrol.
| Compound Name | nonane-1,2,3,9-tetrol |
|---|---|
| PubChem CID | 87488161 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | nonane-1,2,3,9-tetrol |
| SMILES | OCCCCCCC(O)C(O)CO |
| InChI | InChI=1S/C9H20O4/c10-6-4-2-1-3-5-8(12)9(13)7-11/h8-13H,1-7H2 |
| InChIKey | GDNJENMSVPFUQC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|