About 9-methyldecane-1,8-diol
9-methyldecane-1,8-diol (PubChem CID 107094660) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is 9-methyldecane-1,8-diol.
Molecular Properties
| Compound Name | 9-methyldecane-1,8-diol |
| PubChem CID | 107094660 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 9-methyldecane-1,8-diol |
| SMILES | CC(C)C(O)CCCCCCCO |
| InChI | InChI=1S/C11H24O2/c1-10(2)11(13)8-6-4-3-5-7-9-12/h10-13H,3-9H2,1-2H3 |
| InChIKey | JRJIGZQFKSSJPC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-methyldecane-1,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyldecane-1,8-diol?
The IUPAC name of 9-methyldecane-1,8-diol (CID 107094660) is 9-methyldecane-1,8-diol.
What is the SMILES notation for 9-methyldecane-1,8-diol?
The canonical SMILES for 9-methyldecane-1,8-diol is CC(C)C(O)CCCCCCCO.
What is the InChIKey of 9-methyldecane-1,8-diol?
The InChIKey is JRJIGZQFKSSJPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2/c1-10(2)11(13)8-6-4-3-5-7-9-12/h10-13H,3-9H2,1-2H3.
What are the key properties of 9-methyldecane-1,8-diol?
9-methyldecane-1,8-diol has a molecular weight of 188.31 g/mol, XLogP of 2.34, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyldecane-1,8-diol is sourced from PubChem (CID 107094660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).