About 8-bromononan-1-ol
8-bromononan-1-ol (PubChem CID 18177005) has the molecular formula C9H19BrO
and a molecular weight of 223.15 g/mol. Its IUPAC name is 8-bromononan-1-ol.
Molecular Properties
| Compound Name | 8-bromononan-1-ol |
| PubChem CID | 18177005 |
| Molecular Formula | C9H19BrO |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 8-bromononan-1-ol |
| SMILES | CC(Br)CCCCCCCO |
| InChI | InChI=1S/C9H19BrO/c1-9(10)7-5-3-2-4-6-8-11/h9,11H,2-8H2,1H3 |
| InChIKey | FAKIVYWHXMZKOQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-bromononan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromononan-1-ol?
The IUPAC name of 8-bromononan-1-ol (CID 18177005) is 8-bromononan-1-ol.
What is the SMILES notation for 8-bromononan-1-ol?
The canonical SMILES for 8-bromononan-1-ol is CC(Br)CCCCCCCO.
What is the InChIKey of 8-bromononan-1-ol?
The InChIKey is FAKIVYWHXMZKOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19BrO/c1-9(10)7-5-3-2-4-6-8-11/h9,11H,2-8H2,1H3.
What are the key properties of 8-bromononan-1-ol?
8-bromononan-1-ol has a molecular weight of 223.15 g/mol, XLogP of 3.10, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromononan-1-ol is sourced from PubChem (CID 18177005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).