About 2-bromo-8-methylnonane
2-bromo-8-methylnonane (PubChem CID 83169222) has the molecular formula C10H21Br
and a molecular weight of 221.18 g/mol. Its IUPAC name is 2-bromo-8-methylnonane.
Molecular Properties
| Compound Name | 2-bromo-8-methylnonane |
| PubChem CID | 83169222 |
| Molecular Formula | C10H21Br |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-bromo-8-methylnonane |
| SMILES | CC(C)CCCCCC(C)Br |
| InChI | InChI=1S/C10H21Br/c1-9(2)7-5-4-6-8-10(3)11/h9-10H,4-8H2,1-3H3 |
| InChIKey | PUQKRNYKATVDOP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-8-methylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-8-methylnonane?
The IUPAC name of 2-bromo-8-methylnonane (CID 83169222) is 2-bromo-8-methylnonane.
What is the SMILES notation for 2-bromo-8-methylnonane?
The canonical SMILES for 2-bromo-8-methylnonane is CC(C)CCCCCC(C)Br.
What is the InChIKey of 2-bromo-8-methylnonane?
The InChIKey is PUQKRNYKATVDOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21Br/c1-9(2)7-5-4-6-8-10(3)11/h9-10H,4-8H2,1-3H3.
What are the key properties of 2-bromo-8-methylnonane?
2-bromo-8-methylnonane has a molecular weight of 221.18 g/mol, XLogP of 4.38, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-8-methylnonane is sourced from PubChem (CID 83169222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).