About 2,22-dimethyltricosane
2,22-dimethyltricosane (PubChem CID 58100191) has the molecular formula C25H52
and a molecular weight of 352.69 g/mol. Its IUPAC name is 2,22-dimethyltricosane.
Molecular Properties
| Compound Name | 2,22-dimethyltricosane |
| PubChem CID | 58100191 |
| Molecular Formula | C25H52 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 352.41 |
| IUPAC Name | 2,22-dimethyltricosane |
| SMILES | CC(C)CCCCCCCCCCCCCCCCCCCC(C)C |
| InChI | InChI=1S/C25H52/c1-24(2)22-20-18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-21-23-25(3)4/h24-25H,5-23H2,1-4H3 |
| InChIKey | OSUXCHNNUDOIET-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,22-dimethyltricosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,22-dimethyltricosane?
The IUPAC name of 2,22-dimethyltricosane (CID 58100191) is 2,22-dimethyltricosane.
What is the SMILES notation for 2,22-dimethyltricosane?
The canonical SMILES for 2,22-dimethyltricosane is CC(C)CCCCCCCCCCCCCCCCCCCC(C)C.
What is the InChIKey of 2,22-dimethyltricosane?
The InChIKey is OSUXCHNNUDOIET-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H52/c1-24(2)22-20-18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-21-23-25(3)4/h24-25H,5-23H2,1-4H3.
What are the key properties of 2,22-dimethyltricosane?
2,22-dimethyltricosane has a molecular weight of 352.69 g/mol, XLogP of 9.71, 20 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,22-dimethyltricosane is sourced from PubChem (CID 58100191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).