About CID 151699977
CID 151699977 (PubChem CID 151699977) has the molecular formula C18H37Bi
and a molecular weight of 462.47 g/mol.
Molecular Properties
| Compound Name | CID 151699977 |
| PubChem CID | 151699977 |
| Molecular Formula | C18H37Bi |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | — |
| SMILES | CC(C)CCCCCCCCCCCCCCC[Bi] |
| InChI | InChI=1S/C18H37.Bi/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)3;/h18H,1,4-17H2,2-3H3; |
| InChIKey | REJKGBJZXVVZLU-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 151699977 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 151699977?
The IUPAC name of CID 151699977 (CID 151699977) is not available.
What is the SMILES notation for CID 151699977?
The canonical SMILES for CID 151699977 is CC(C)CCCCCCCCCCCCCCC[Bi].
What is the InChIKey of CID 151699977?
The InChIKey is REJKGBJZXVVZLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37.Bi/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)3;/h18H,1,4-17H2,2-3H3;.
What are the key properties of CID 151699977?
CID 151699977 has a molecular weight of 462.47 g/mol, XLogP of 6.69, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 151699977 is sourced from PubChem (CID 151699977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).