About 1-iodo-21-methyldocosane
1-iodo-21-methyldocosane (PubChem CID 140840720) has the molecular formula C23H47I
and a molecular weight of 450.53 g/mol. Its IUPAC name is 1-iodo-21-methyldocosane.
Molecular Properties
| Compound Name | 1-iodo-21-methyldocosane |
| PubChem CID | 140840720 |
| Molecular Formula | C23H47I |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 1-iodo-21-methyldocosane |
| SMILES | CC(C)CCCCCCCCCCCCCCCCCCCCI |
| InChI | InChI=1S/C23H47I/c1-23(2)21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24/h23H,3-22H2,1-2H3 |
| InChIKey | NREWBLAOKFWUSM-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-21-methyldocosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-21-methyldocosane?
The IUPAC name of 1-iodo-21-methyldocosane (CID 140840720) is 1-iodo-21-methyldocosane.
What is the SMILES notation for 1-iodo-21-methyldocosane?
The canonical SMILES for 1-iodo-21-methyldocosane is CC(C)CCCCCCCCCCCCCCCCCCCCI.
What is the InChIKey of 1-iodo-21-methyldocosane?
The InChIKey is NREWBLAOKFWUSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H47I/c1-23(2)21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24/h23H,3-22H2,1-2H3.
What are the key properties of 1-iodo-21-methyldocosane?
1-iodo-21-methyldocosane has a molecular weight of 450.53 g/mol, XLogP of 9.49, 20 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-21-methyldocosane is sourced from PubChem (CID 140840720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).