About 1,7-diiodooctane
1,7-diiodooctane (PubChem CID 168864689) has the molecular formula C8H16I2
and a molecular weight of 366.02 g/mol. Its IUPAC name is 1,7-diiodooctane.
Molecular Properties
| Compound Name | 1,7-diiodooctane |
| PubChem CID | 168864689 |
| Molecular Formula | C8H16I2 |
| Molecular Weight | 366.02 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | 1,7-diiodooctane |
| SMILES | CC(I)CCCCCCI |
| InChI | InChI=1S/C8H16I2/c1-8(10)6-4-2-3-5-7-9/h8H,2-7H2,1H3 |
| InChIKey | DYPAJUYNFQWGFN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.02 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,7-diiodooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-diiodooctane?
The IUPAC name of 1,7-diiodooctane (CID 168864689) is 1,7-diiodooctane.
What is the SMILES notation for 1,7-diiodooctane?
The canonical SMILES for 1,7-diiodooctane is CC(I)CCCCCCI.
What is the InChIKey of 1,7-diiodooctane?
The InChIKey is DYPAJUYNFQWGFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16I2/c1-8(10)6-4-2-3-5-7-9/h8H,2-7H2,1H3.
What are the key properties of 1,7-diiodooctane?
1,7-diiodooctane has a molecular weight of 366.02 g/mol, XLogP of 4.20, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-diiodooctane is sourced from PubChem (CID 168864689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).