C11H21I3 — CID 19808234
1,2,11-triiodoundecane (PubChem CID 19808234) has the molecular formula C11H21I3 and a molecular weight of 534.00 g/mol. Its IUPAC name is 1,2,11-triiodoundecane.
| Compound Name | 1,2,11-triiodoundecane |
|---|---|
| PubChem CID | 19808234 |
| Molecular Formula | C11H21I3 |
| Molecular Weight | 534.00 g/mol |
| Exact Mass | 533.88 |
| IUPAC Name | 1,2,11-triiodoundecane |
| SMILES | ICCCCCCCCCC(I)CI |
| InChI | InChI=1S/C11H21I3/c12-9-7-5-3-1-2-4-6-8-11(14)10-13/h11H,1-10H2 |
| InChIKey | MCADOHOONYHLNC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.00 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|