C9H16I2O3 — CID 118276205
3,9-diiodonon-1-ene-1,1,2-triol (PubChem CID 118276205) has the molecular formula C9H16I2O3 and a molecular weight of 426.03 g/mol. Its IUPAC name is 3,9-diiodonon-1-ene-1,1,2-triol.
| Compound Name | 3,9-diiodonon-1-ene-1,1,2-triol |
|---|---|
| PubChem CID | 118276205 |
| Molecular Formula | C9H16I2O3 |
| Molecular Weight | 426.03 g/mol |
| Exact Mass | 425.92 |
| IUPAC Name | 3,9-diiodonon-1-ene-1,1,2-triol |
| SMILES | OC(O)=C(O)C(I)CCCCCCI |
| InChI | InChI=1S/C9H16I2O3/c10-6-4-2-1-3-5-7(11)8(12)9(13)14/h7,12-14H,1-6H2 |
| InChIKey | XMODIJQWGZDRGN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.03 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|