About 2-iodotetradecanoic acid
2-iodotetradecanoic acid (PubChem CID 536352) has the molecular formula C14H27IO2
and a molecular weight of 354.27 g/mol. Its IUPAC name is 2-iodotetradecanoic acid.
Molecular Properties
| Compound Name | 2-iodotetradecanoic acid |
| PubChem CID | 536352 |
| Molecular Formula | C14H27IO2 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-iodotetradecanoic acid |
| SMILES | CCCCCCCCCCCCC(I)C(=O)O |
| InChI | InChI=1S/C14H27IO2/c1-2-3-4-5-6-7-8-9-10-11-12-13(15)14(16)17/h13H,2-12H2,1H3,(H,16,17) |
| InChIKey | YSHOYJQGMUAOFX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodotetradecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodotetradecanoic acid?
The IUPAC name of 2-iodotetradecanoic acid (CID 536352) is 2-iodotetradecanoic acid.
What is the SMILES notation for 2-iodotetradecanoic acid?
The canonical SMILES for 2-iodotetradecanoic acid is CCCCCCCCCCCCC(I)C(=O)O.
What is the InChIKey of 2-iodotetradecanoic acid?
The InChIKey is YSHOYJQGMUAOFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27IO2/c1-2-3-4-5-6-7-8-9-10-11-12-13(15)14(16)17/h13H,2-12H2,1H3,(H,16,17).
What are the key properties of 2-iodotetradecanoic acid?
2-iodotetradecanoic acid has a molecular weight of 354.27 g/mol, XLogP of 5.19, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodotetradecanoic acid is sourced from PubChem (CID 536352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).