About sodium 2-iodododecanoate
sodium 2-iodododecanoate (PubChem CID 141360253) has the molecular formula C12H22INaO2
and a molecular weight of 348.20 g/mol. Its IUPAC name is sodium 2-iodododecanoate.
Molecular Properties
| Compound Name | sodium 2-iodododecanoate |
| PubChem CID | 141360253 |
| Molecular Formula | C12H22INaO2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | sodium 2-iodododecanoate |
| SMILES | CCCCCCCCCCC(I)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C12H23IO2.Na/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15;/h11H,2-10H2,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | NFSWNMNQLOPTLR-UHFFFAOYSA-M |
| XLogP | 0.07 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-iodododecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-iodododecanoate?
The IUPAC name of sodium 2-iodododecanoate (CID 141360253) is sodium 2-iodododecanoate.
What is the SMILES notation for sodium 2-iodododecanoate?
The canonical SMILES for sodium 2-iodododecanoate is CCCCCCCCCCC(I)C(=O)[O-].[Na+].
What is the InChIKey of sodium 2-iodododecanoate?
The InChIKey is NFSWNMNQLOPTLR-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H23IO2.Na/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15;/h11H,2-10H2,1H3,(H,14,15);/q;+1/p-1.
What are the key properties of sodium 2-iodododecanoate?
sodium 2-iodododecanoate has a molecular weight of 348.20 g/mol, XLogP of 0.07, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-iodododecanoate is sourced from PubChem (CID 141360253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).