About 2-butylnonanoate
2-butylnonanoate (PubChem CID 20977072) has the molecular formula C13H25O2-
and a molecular weight of 213.34 g/mol. Its IUPAC name is 2-butylnonanoate.
Molecular Properties
| Compound Name | 2-butylnonanoate |
| PubChem CID | 20977072 |
| Molecular Formula | C13H25O2- |
| Molecular Weight | 213.34 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | 2-butylnonanoate |
| SMILES | CCCCCCCC(CCCC)C(=O)[O-] |
| InChI | InChI=1S/C13H26O2/c1-3-5-7-8-9-11-12(13(14)15)10-6-4-2/h12H,3-11H2,1-2H3,(H,14,15)/p-1 |
| InChIKey | BDWTUWFDMGJTOD-UHFFFAOYSA-M |
| XLogP | 2.90 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylnonanoate?
The IUPAC name of 2-butylnonanoate (CID 20977072) is 2-butylnonanoate.
What is the SMILES notation for 2-butylnonanoate?
The canonical SMILES for 2-butylnonanoate is CCCCCCCC(CCCC)C(=O)[O-].
What is the InChIKey of 2-butylnonanoate?
The InChIKey is BDWTUWFDMGJTOD-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H26O2/c1-3-5-7-8-9-11-12(13(14)15)10-6-4-2/h12H,3-11H2,1-2H3,(H,14,15)/p-1.
What are the key properties of 2-butylnonanoate?
2-butylnonanoate has a molecular weight of 213.34 g/mol, XLogP of 2.90, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylnonanoate is sourced from PubChem (CID 20977072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).