About potassium 2-ethyldodecanoate
potassium 2-ethyldodecanoate (PubChem CID 90238812) has the molecular formula C14H27KO2
and a molecular weight of 266.47 g/mol. Its IUPAC name is potassium 2-ethyldodecanoate.
Molecular Properties
| Compound Name | potassium 2-ethyldodecanoate |
| PubChem CID | 90238812 |
| Molecular Formula | C14H27KO2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | potassium 2-ethyldodecanoate |
| SMILES | CCCCCCCCCCC(CC)C(=O)[O-].[K+] |
| InChI | InChI=1S/C14H28O2.K/c1-3-5-6-7-8-9-10-11-12-13(4-2)14(15)16;/h13H,3-12H2,1-2H3,(H,15,16);/q;+1/p-1 |
| InChIKey | DRXIBYQVPPXQSD-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium 2-ethyldodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-ethyldodecanoate?
The IUPAC name of potassium 2-ethyldodecanoate (CID 90238812) is potassium 2-ethyldodecanoate.
What is the SMILES notation for potassium 2-ethyldodecanoate?
The canonical SMILES for potassium 2-ethyldodecanoate is CCCCCCCCCCC(CC)C(=O)[O-].[K+].
What is the InChIKey of potassium 2-ethyldodecanoate?
The InChIKey is DRXIBYQVPPXQSD-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H28O2.K/c1-3-5-6-7-8-9-10-11-12-13(4-2)14(15)16;/h13H,3-12H2,1-2H3,(H,15,16);/q;+1/p-1.
What are the key properties of potassium 2-ethyldodecanoate?
potassium 2-ethyldodecanoate has a molecular weight of 266.47 g/mol, XLogP of 0.30, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-ethyldodecanoate is sourced from PubChem (CID 90238812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).