About (2S)-2-butyloctanoate
(2S)-2-butyloctanoate (PubChem CID 86308644) has the molecular formula C12H23O2-
and a molecular weight of 199.31 g/mol. Its IUPAC name is (2S)-2-butyloctanoate.
Molecular Properties
| Compound Name | (2S)-2-butyloctanoate |
| PubChem CID | 86308644 |
| Molecular Formula | C12H23O2- |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (2S)-2-butyloctanoate |
| SMILES | CCCCCC[C@H](CCCC)C(=O)[O-] |
| InChI | InChI=1S/C12H24O2/c1-3-5-7-8-10-11(12(13)14)9-6-4-2/h11H,3-10H2,1-2H3,(H,13,14)/p-1/t11-/m0/s1 |
| InChIKey | OARDBPIZDHVTCK-NSHDSACASA-M |
| XLogP | 2.51 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-butyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-butyloctanoate?
The IUPAC name of (2S)-2-butyloctanoate (CID 86308644) is (2S)-2-butyloctanoate.
What is the SMILES notation for (2S)-2-butyloctanoate?
The canonical SMILES for (2S)-2-butyloctanoate is CCCCCC[C@H](CCCC)C(=O)[O-].
What is the InChIKey of (2S)-2-butyloctanoate?
The InChIKey is OARDBPIZDHVTCK-NSHDSACASA-M. The full InChI is InChI=1S/C12H24O2/c1-3-5-7-8-10-11(12(13)14)9-6-4-2/h11H,3-10H2,1-2H3,(H,13,14)/p-1/t11-/m0/s1.
What are the key properties of (2S)-2-butyloctanoate?
(2S)-2-butyloctanoate has a molecular weight of 199.31 g/mol, XLogP of 2.51, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-butyloctanoate is sourced from PubChem (CID 86308644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).