About barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate
barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate (PubChem CID 138397224) has the molecular formula C20H40BaO3S
and a molecular weight of 497.93 g/mol. Its IUPAC name is barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate.
Molecular Properties
| Compound Name | barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate |
| PubChem CID | 138397224 |
| Molecular Formula | C20H40BaO3S |
| Molecular Weight | 497.93 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate |
| SMILES | CCCCCCCCCCCCCCCCC(CC[S-])C(=O)[O-].O.[Ba+2] |
| InChI | InChI=1S/C20H40O2S.Ba.H2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(17-18-23)20(21)22;;/h19,23H,2-18H2,1H3,(H,21,22);;1H2/q;+2;/p-2 |
| InChIKey | MPXSLTBJVXTEBH-UHFFFAOYSA-L |
| XLogP | 3.96 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.93 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate?
The IUPAC name of barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate (CID 138397224) is barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate.
What is the SMILES notation for barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate?
The canonical SMILES for barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate is CCCCCCCCCCCCCCCCC(CC[S-])C(=O)[O-].O.[Ba+2].
What is the InChIKey of barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate?
The InChIKey is MPXSLTBJVXTEBH-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H40O2S.Ba.H2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(17-18-23)20(21)22;;/h19,23H,2-18H2,1H3,(H,21,22);;1H2/q;+2;/p-2.
What are the key properties of barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate?
barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate has a molecular weight of 497.93 g/mol, XLogP of 3.96, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);2-(2-sulfidoethyl)octadecanoate;hydrate is sourced from PubChem (CID 138397224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).