About lithium 2-ethyloctanoate
lithium 2-ethyloctanoate (PubChem CID 155386691) has the molecular formula C10H19LiO2
and a molecular weight of 178.20 g/mol. Its IUPAC name is lithium 2-ethyloctanoate.
Molecular Properties
| Compound Name | lithium 2-ethyloctanoate |
| PubChem CID | 155386691 |
| Molecular Formula | C10H19LiO2 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | lithium 2-ethyloctanoate |
| SMILES | CCCCCCC(CC)C(=O)[O-].[Li+] |
| InChI | InChI=1S/C10H20O2.Li/c1-3-5-6-7-8-9(4-2)10(11)12;/h9H,3-8H2,1-2H3,(H,11,12);/q;+1/p-1 |
| InChIKey | BBNLOWIWTRCAJZ-UHFFFAOYSA-M |
| XLogP | -1.26 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze lithium 2-ethyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-ethyloctanoate?
The IUPAC name of lithium 2-ethyloctanoate (CID 155386691) is lithium 2-ethyloctanoate.
What is the SMILES notation for lithium 2-ethyloctanoate?
The canonical SMILES for lithium 2-ethyloctanoate is CCCCCCC(CC)C(=O)[O-].[Li+].
What is the InChIKey of lithium 2-ethyloctanoate?
The InChIKey is BBNLOWIWTRCAJZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20O2.Li/c1-3-5-6-7-8-9(4-2)10(11)12;/h9H,3-8H2,1-2H3,(H,11,12);/q;+1/p-1.
What are the key properties of lithium 2-ethyloctanoate?
lithium 2-ethyloctanoate has a molecular weight of 178.20 g/mol, XLogP of -1.26, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-ethyloctanoate is sourced from PubChem (CID 155386691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).