About gallium 2-ethylhexanoate
gallium 2-ethylhexanoate (PubChem CID 21118224) has the molecular formula C8H15GaO2+2
and a molecular weight of 212.93 g/mol. Its IUPAC name is gallium 2-ethylhexanoate.
Molecular Properties
| Compound Name | gallium 2-ethylhexanoate |
| PubChem CID | 21118224 |
| Molecular Formula | C8H15GaO2+2 |
| Molecular Weight | 212.93 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | gallium 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)[O-].[Ga+3] |
| InChI | InChI=1S/C8H16O2.Ga/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+3/p-1 |
| InChIKey | SSVPWOYIEZBICH-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.93 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze gallium 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gallium 2-ethylhexanoate?
The IUPAC name of gallium 2-ethylhexanoate (CID 21118224) is gallium 2-ethylhexanoate.
What is the SMILES notation for gallium 2-ethylhexanoate?
The canonical SMILES for gallium 2-ethylhexanoate is CCCCC(CC)C(=O)[O-].[Ga+3].
What is the InChIKey of gallium 2-ethylhexanoate?
The InChIKey is SSVPWOYIEZBICH-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2.Ga/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+3/p-1.
What are the key properties of gallium 2-ethylhexanoate?
gallium 2-ethylhexanoate has a molecular weight of 212.93 g/mol, XLogP of 0.57, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gallium 2-ethylhexanoate is sourced from PubChem (CID 21118224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).