About 2-ethylhexanoate;bis(nickel(2+));acetate
2-ethylhexanoate;bis(nickel(2+));acetate (PubChem CID 19733896) has the molecular formula C10H18Ni2O4+2
and a molecular weight of 319.64 g/mol. Its IUPAC name is 2-ethylhexanoate;bis(nickel(2+));acetate.
Molecular Properties
| Compound Name | 2-ethylhexanoate;bis(nickel(2+));acetate |
| PubChem CID | 19733896 |
| Molecular Formula | C10H18Ni2O4+2 |
| Molecular Weight | 319.64 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 2-ethylhexanoate;bis(nickel(2+));acetate |
| SMILES | CC(=O)[O-].CCCCC(CC)C(=O)[O-].[Ni+2].[Ni+2] |
| InChI | InChI=1S/C8H16O2.C2H4O2.2Ni/c1-3-5-6-7(4-2)8(9)10;1-2(3)4;;/h7H,3-6H2,1-2H3,(H,9,10);1H3,(H,3,4);;/q;;2*+2/p-2 |
| InChIKey | NJCDUEYDGRDAGM-UHFFFAOYSA-L |
| XLogP | -0.30 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.64 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylhexanoate;bis(nickel(2+));acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanoate;bis(nickel(2+));acetate?
The IUPAC name of 2-ethylhexanoate;bis(nickel(2+));acetate (CID 19733896) is 2-ethylhexanoate;bis(nickel(2+));acetate.
What is the SMILES notation for 2-ethylhexanoate;bis(nickel(2+));acetate?
The canonical SMILES for 2-ethylhexanoate;bis(nickel(2+));acetate is CC(=O)[O-].CCCCC(CC)C(=O)[O-].[Ni+2].[Ni+2].
What is the InChIKey of 2-ethylhexanoate;bis(nickel(2+));acetate?
The InChIKey is NJCDUEYDGRDAGM-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H16O2.C2H4O2.2Ni/c1-3-5-6-7(4-2)8(9)10;1-2(3)4;;/h7H,3-6H2,1-2H3,(H,9,10);1H3,(H,3,4);;/q;;2*+2/p-2.
What are the key properties of 2-ethylhexanoate;bis(nickel(2+));acetate?
2-ethylhexanoate;bis(nickel(2+));acetate has a molecular weight of 319.64 g/mol, XLogP of -0.30, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanoate;bis(nickel(2+));acetate is sourced from PubChem (CID 19733896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).