About bis(2-ethylhexanoate);molybdenum(2+)
bis(2-ethylhexanoate);molybdenum(2+) (PubChem CID 19602338) has the molecular formula C16H30MoO4
and a molecular weight of 382.35 g/mol. Its IUPAC name is bis(2-ethylhexanoate);molybdenum(2+).
Molecular Properties
| Compound Name | bis(2-ethylhexanoate);molybdenum(2+) |
| PubChem CID | 19602338 |
| Molecular Formula | C16H30MoO4 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | bis(2-ethylhexanoate);molybdenum(2+) |
| SMILES | CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Mo+2] |
| InChI | InChI=1S/2C8H16O2.Mo/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | GFMUYCGLRBKPJO-UHFFFAOYSA-L |
| XLogP | 1.90 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-ethylhexanoate);molybdenum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethylhexanoate);molybdenum(2+)?
The IUPAC name of bis(2-ethylhexanoate);molybdenum(2+) (CID 19602338) is bis(2-ethylhexanoate);molybdenum(2+).
What is the SMILES notation for bis(2-ethylhexanoate);molybdenum(2+)?
The canonical SMILES for bis(2-ethylhexanoate);molybdenum(2+) is CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Mo+2].
What is the InChIKey of bis(2-ethylhexanoate);molybdenum(2+)?
The InChIKey is GFMUYCGLRBKPJO-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H16O2.Mo/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2.
What are the key properties of bis(2-ethylhexanoate);molybdenum(2+)?
bis(2-ethylhexanoate);molybdenum(2+) has a molecular weight of 382.35 g/mol, XLogP of 1.90, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethylhexanoate);molybdenum(2+) is sourced from PubChem (CID 19602338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).