About CID 21474875
CID 21474875 (PubChem CID 21474875) has the molecular formula C8H15O2Pb-
and a molecular weight of 350.41 g/mol.
Molecular Properties
| Compound Name | CID 21474875 |
| PubChem CID | 21474875 |
| Molecular Formula | C8H15O2Pb- |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)C(=O)[O-].[Pb] |
| InChI | InChI=1S/C8H16O2.Pb/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/p-1 |
| InChIKey | ONQAUOMFCUFPBJ-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 21474875 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21474875?
The IUPAC name of CID 21474875 (CID 21474875) is not available.
What is the SMILES notation for CID 21474875?
The canonical SMILES for CID 21474875 is CCCCC(CC)C(=O)[O-].[Pb].
What is the InChIKey of CID 21474875?
The InChIKey is ONQAUOMFCUFPBJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2.Pb/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/p-1.
What are the key properties of CID 21474875?
CID 21474875 has a molecular weight of 350.41 g/mol, XLogP of 0.57, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21474875 is sourced from PubChem (CID 21474875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).