About 2-iodododecanamide
2-iodododecanamide (PubChem CID 57350654) has the molecular formula C12H24INO
and a molecular weight of 325.23 g/mol. Its IUPAC name is 2-iodododecanamide.
Molecular Properties
| Compound Name | 2-iodododecanamide |
| PubChem CID | 57350654 |
| Molecular Formula | C12H24INO |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-iodododecanamide |
| SMILES | CCCCCCCCCCC(I)C(N)=O |
| InChI | InChI=1S/C12H24INO/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15/h11H,2-10H2,1H3,(H2,14,15) |
| InChIKey | LVOKRQGWEPOURA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodododecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodododecanamide?
The IUPAC name of 2-iodododecanamide (CID 57350654) is 2-iodododecanamide.
What is the SMILES notation for 2-iodododecanamide?
The canonical SMILES for 2-iodododecanamide is CCCCCCCCCCC(I)C(N)=O.
What is the InChIKey of 2-iodododecanamide?
The InChIKey is LVOKRQGWEPOURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24INO/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15/h11H,2-10H2,1H3,(H2,14,15).
What are the key properties of 2-iodododecanamide?
2-iodododecanamide has a molecular weight of 325.23 g/mol, XLogP of 3.81, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodododecanamide is sourced from PubChem (CID 57350654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).